Diethyldihydro-2H-pyran-4,4(3H)-dicarboxylate
CasNo： 5382-77-4
Categories： Carboxylic Acids & Derivatives (Esters, Acyl Chlorides)
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC85172 | Diethyldihydro-2H-pyran-4,4(3H)-dicarboxylate | 98% | 1g | 0 | $ 237.58 | ~30 days | |
| Apinno | GC85172 | Diethyldihydro-2H-pyran-4,4(3H)-dicarboxylate | 98% | 250mg | 0 | $ 91.70 | ~30 days |
Diethyldimethylmalonate, 97%
CasNo： 1619-62-1
Molecular Formula： C9H16O4
Molecular Weight： 188.22
Categories： Carboxylic Acids & Derivatives (Esters, Acyl Chlorides)
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A05028 | Diethyldimethylmalonate, 97% | 97% | 1g | 14 | $ 5.60 | 7-14 days | |
| Innochem | A05028 | Diethyldimethylmalonate, 97% | 97% | 25g | 2 | $ 93.10 | 7-14 days | |
| Innochem | A05028 | Diethyldimethylmalonate, 97% | 97% | 5g | 6 | $ 21.00 | 7-14 days | |
| Apinno | GC68302 | DIETHYLDIMETHYLMALONATE | 97% | 10g | 0 | $ 103.88 | ~30 days | |
| Apinno | GC68302 | DIETHYLDIMETHYLMALONATE | 97% | 1g | 0 | $ 12.60 | ~30 days | |
| Apinno | GC68302 | DIETHYLDIMETHYLMALONATE | 97% | 5g | 0 | $ 62.16 | ~30 days |
Diethyldiselenide,98%
CasNo： 628-39-7
Molecular Formula： C4H10Se2
Molecular Weight： 216.04
Categories： Organic Building Blocks—Ethers
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A62346 | Diethyldiselenide,98% | 1g | 0 | $ 70.56 | ~30 days | ||
| Innochem | A62346 | Diethyldiselenide,98% | 5g | 0 | $ 282.24 | ~30 days | ||
| Innochem | A62346 | Diethyldiselenide,98% | 10g | 0 | $ 0.00 | ~30 days | ||
| Innochem | A62346 | Diethyldiselenide,98% | 500mg | 0 | $ 49.00 | ~30 days | ||
| Apinno | GC119555 | 25g | 0 | $ 648.76 | ~30 days |
Diethyldithieno[3,2-b:2',3'-d]thiophene-2,6-dicarboxylate
![Diethyldithieno[3,2-b:2',3'-d]thiophene-2,6-dicarboxylate](https://static.inno-chem.com.cn/product/structural/img/502764-52-5)
CasNo： 502764-52-5
Categories： Heterocyclic Building Blocks—Sulfur Heterocycles
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC100712 | Diethyldithieno[3,2-b:2',3'-d]thiophene-2,6-dicarboxylate | 97% | 5g | 0 | $ 154.42 | ~30 days | |
| Apinno | GC100712 | Diethyldithieno[3,2-b:2',3'-d]thiophene-2,6-dicarboxylate | 97% | 250mg | 0 | $ 9.66 | ~30 days | |
| Apinno | GC100712 | Diethyldithieno[3,2-b:2',3'-d]thiophene-2,6-dicarboxylate | 97% | 1g | 0 | $ 33.74 | ~30 days |
Diethylene glycol di(p-toluenesulfonate), 98%
CasNo： 7460-82-4
Categories： Sulfoxides, Sulfonic Acids, Sulfinic Acids and Derivatives
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A12983 | Diethylene glycol di(p-toluenesulfonate), 98% | 98% | 25g | 4 | $ 11.20 | 7-14 days | |
| Innochem | A12983 | Diethylene glycol di(p-toluenesulfonate), 98% | 98% | 5g | 0 | $ 2.94 | ~30 days | |
| Innochem | A12983 | Diethylene glycol di(p-toluenesulfonate), 98% | 98% | 200g | 0 | $ 0.00 | ~30 days | |
| Apinno | GC92685 | DIETHYLENEGLYCOLBIS(P-TOLUENESULFONATE) | 97% | 500g | 0 | $ 189.70 | ~30 days | |
| Apinno | GC92685 | DIETHYLENEGLYCOLBIS(P-TOLUENESULFONATE) | 97% | 100g | 0 | $ 38.08 | ~30 days |
Diethylene glycol dibutyl ether, 99%
CasNo： 112-73-2
Molecular Formula： C12H26O3
Molecular Weight： 218.33
Categories： Organic Building Blocks—Ethers
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A01764 | Diethylene glycol dibutyl ether, 99% | 99% | 100ml | 12 | $ 10.22 | 7-14 days | |
| Innochem | A01764 | Diethylene glycol dibutyl ether, 99% | 99% | 2.5L | 7 | $ 52.64 | 7-14 days | |
| Innochem | A01764 | Diethylene glycol dibutyl ether, 99% | 99% | 500ml | 10 | $ 28.70 | 7-14 days |
Diethylene glycol dimethyl ether, 99.9%
CasNo： 111-96-6
Molecular Formula： C6H14O3
Molecular Weight： 134.17
Categories： Organic Building Blocks—Ethers
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A40414 | Diethylene glycol dimethyl ether, 99.9% | 99.90% | 100ML | 10 | $ 4.90 | 7-14 days | |
| Innochem | A40414 | Diethylene glycol dimethyl ether, 99.9% | 99.90% | 25ML | 0 | $ 4.20 | ~30 days | |
| Innochem | A40414 | Diethylene glycol dimethyl ether, 99.9% | 99.90% | 500ML | 5 | $ 10.50 | 7-14 days | |
| Innochem | A40414 | Diethylene glycol dimethyl ether, 99.9% | 99.90% | 25kg | 0 | $ 672.00 | ~30 days | |
| Innochem | A40414 | Diethylene glycol dimethyl ether, 99.9% | 99.90% | 15ML | 0 | $ 3.50 | ~30 days | |
| Innochem | A40414 | Diethylene glycol dimethyl ether, 99.9% | 99.90% | 14ML | 0 | $ 2.10 | ~30 days | |
| Innochem | A01572 | Diethylene glycol dimethyl ethe, extra dry with molecular sieves, water≤50 ppm, in resealable bottle | 99.00% | 100ml | 0 | $ 9.10 | ~30 days | |
| Innochem | A01572 | Diethylene glycol dimethyl ethe, extra dry with molecular sieves, water≤50 ppm, in resealable bottle | 99.00% | 1L | 0 | $ 41.72 | ~30 days | |
| Innochem | A01572 | Diethylene glycol dimethyl ethe, extra dry with molecular sieves, water≤50 ppm, in resealable bottle | 99.00% | 500ml | 0 | $ 23.66 | ~30 days | |
| Innochem | I13557 | "电池级，纯度: 99.8% min 水分: 20ppm max" | 250g/瓶 | 0 | $ 81.53 | ~30 days | ||
| Innochem | A40414 | Diethylene glycol dimethyl ether, 99.9% | 99.90% | 50kg | 0 | $ 525.00 | ~30 days | |
| Innochem | A74155 | Bis(2-methoxyethyl) ether, 99%, Extra pure | 99%, Extra pure | 250ML | 1 | $ 57.96 | 7-14 days | |
| Innochem | A82185 | Bis(2-methoxyethyl) ether, 99+%, Extra dry | 99+%, Extra dry | 100ML | 0 | $ 94.92 | ~30 days | |
| Innochem | A20489 | 99.50% | 500ml | 29 | $ 10.50 | 7-14 days | ||
| Innochem | I17996 | 99.8% min | 250g/瓶 | 0 | $ 81.53 | ~30 days |
Diethylene glycol monohexyl ether, 96%
CasNo： 112-59-4
Molecular Formula： CH3(CH2)5OCH2CH2OCH2CH2OH
Molecular Weight： 190.28
Categories： Organic Building Blocks—Ethers
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A04467 | Diethylene glycol monohexyl ether, 96% | 100ml | 8 | $ 5.18 | 7-14 days | ||
| Innochem | A04467 | Diethylene glycol monohexyl ether, 96% | 500ml | 18 | $ 13.44 | 7-14 days | ||
| Innochem | A04467 | Diethylene glycol monohexyl ether, 96% | 2.5L | 68 | $ 64.54 | 7-14 days |
Diethylene Glycol Monomethyl Ether, 99%(stabilized with BHT)
CasNo： 111-77-3
Molecular Formula： C5H12O3
Molecular Weight： 120.15
Categories： Organic Building Blocks—Ethers
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A13101 | Diethylene Glycol Monomethyl Ether, 99%(stabilized with BHT) | 99%(stabilized with BHT) | 100ml | 2 | $ 5.60 | 7-14 days | |
| Innochem | A13101 | Diethylene Glycol Monomethyl Ether, 99%(stabilized with BHT) | 99%(stabilized with BHT) | 500ml | 27 | $ 9.66 | 7-14 days | |
| Innochem | A13101 | Diethylene Glycol Monomethyl Ether, 99%(stabilized with BHT) | 99%(stabilized with BHT) | 10L | 0 | $ 0.00 | ~30 days | |
| Innochem | A13101 | Diethylene Glycol Monomethyl Ether, 99%(stabilized with BHT) | 99%(stabilized with BHT) | 6ML | 0 | $ 2.10 | ~30 days | |
| Innochem | A13101 | Diethylene Glycol Monomethyl Ether, 99%(stabilized with BHT) | 99%(stabilized with BHT) | 2.5L | 4 | $ 30.66 | 7-14 days |
Diethylene glycol monovinyl ether (stabilized with KOH), 96%
CasNo： 929-37-3
Molecular Formula： C6H12O3
Molecular Weight： 132.16
Categories： Organic Building Blocks—Ethers
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A58094 | Diethylene glycol monovinyl ether (stabilized with KOH), 96% | 96% | 25ml | 19 | $ 8.40 | 7-14 days | |
| Innochem | A58094 | Diethylene glycol monovinyl ether (stabilized with KOH), 96% | 96% | 100ml | 2 | $ 25.20 | 7-14 days |
Diethylene glycol, 99%
CasNo： 111-46-6
Molecular Formula： C4H10O3
Molecular Weight： 106.12
Categories： Organic Building Blocks—Alcohols (Hydroxyalcohols, Thiols)
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A64322 | Diethylene glycol, 99% | 99% | 100ml | 0 | $ 4.20 | ~30 days | |
| Innochem | A64322 | Diethylene glycol, 99% | 99% | 500ml | 51 | $ 7.56 | 7-14 days | |
| Innochem | A64322 | Diethylene glycol, 99% | 99% | 304ml | 0 | $ 6.86 | ~30 days | |
| Innochem | A64322 | Diethylene glycol, 99% | 99% | 260mL | 0 | $ 6.86 | ~30 days | |
| Innochem | A64322 | Diethylene glycol, 99% | 99% | 80L | 0 | $ 0.00 | ~30 days | |
| Innochem | A64322 | Diethylene glycol, 99% | 99% | 15ml | 0 | $ 3.92 | ~30 days | |
| Innochem | A64322 | Diethylene glycol, 99% | 99% | 78ML | 0 | $ 4.06 | ~30 days | |
| Innochem | A64322 | Diethylene glycol, 99% | 99% | 100L | 0 | $ 487.20 | ~30 days | |
| Apinno | GC40447 | Diethyleneglycolstandardsubstance | 250mg | 0 | $ 51.52 | ~30 days |
Diethylenetriamine, 99%
CasNo： 111-40-0
Categories： Organic Amines & Derivatives
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A92358 | Diethylenetriamine, 99% | 100ml | 0 | $ 7.70 | ~30 days | ||
| Innochem | A92358 | Diethylenetriamine, 99% | 500ml | 0 | $ 12.88 | ~30 days | ||
| Innochem | A41119 | Diethylenetriamine, 99% | 99.00% | 100ML | 16 | $ 7.28 | 7-14 days | |
| Innochem | A41119 | Diethylenetriamine, 99% | 99.00% | 500ml | 17 | $ 19.04 | 7-14 days | |
| Innochem | A41119 | Diethylenetriamine, 99% | 99.00% | 43ML | 0 | $ 9.10 | ~30 days | |
| Innochem | A41119 | Diethylenetriamine, 99% | 99.00% | 50kg | 0 | $ 1,142.40 | ~30 days | |
| Innochem | A41119 | Diethylenetriamine, 99% | 99.00% | 250ML | 0 | $ 11.62 | ~30 days | |
| Innochem | A41119 | Diethylenetriamine, 99% | 99.00% | 20L | 0 | $ 203.00 | ~30 days | |
| Apinno | GC111028 | Diethylenetriamine | 10L | 0 | $ 337.96 | ~30 days | ||
| Apinno | GC111028 | Diethylenetriamine | 2.5L | 0 | $ 117.46 | ~30 days | ||
| Apinno | GC111028 | Diethylenetriamine | 5L | 0 | $ 205.66 | ~30 days | ||
| Innochem | A41119 | Diethylenetriamine, 99% | 99.00% | 25ML | 0 | $ 4.20 | ~30 days |
Diethylenetriaminepentaacetic acid dianhydride, 98%
CasNo： 23911-26-4
Molecular Formula： C14H19N3O8
Molecular Weight： 357.32
Categories： Carboxylic Acids & Derivatives (Esters, Acyl Chlorides)
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A13171 | Diethylenetriaminepentaacetic acid dianhydride, 98% | 98% | 1g | 6 | $ 13.72 | 7-14 days | |
| Innochem | A13171 | Diethylenetriaminepentaacetic acid dianhydride, 98% | 98% | 5g | 5 | $ 27.58 | 7-14 days | |
| Innochem | A13171 | Diethylenetriaminepentaacetic acid dianhydride, 98% | 98% | 100g | 0 | $ 0.00 | ~30 days | |
| Apinno | GC131239 | Diethylenetriaminepentaacetic dianhydride | 98% | 25g | 0 | $ 105.14 | ~30 days | |
| Apinno | GC131239 | Diethylenetriaminepentaacetic dianhydride | 98% | 100g | 0 | $ 401.24 | ~30 days |
Diethylethylmalonate
CasNo： 133-13-1
Categories： Carboxylic Acids & Derivatives (Esters, Acyl Chlorides)
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A85579 | Propanedioic acid, 2-ethyl-, 1,3-diethyl ester, 98% | 100g | 0 | $ 16.66 | ~30 days | ||
| Innochem | A85579 | Propanedioic acid, 2-ethyl-, 1,3-diethyl ester, 98% | 25g | 0 | $ 7.70 | ~30 days | ||
| Innochem | A85579 | Propanedioic acid, 2-ethyl-, 1,3-diethyl ester, 98% | 5g | 0 | $ 5.04 | ~30 days | ||
| Apinno | GC68256 | Diethylethylmalonate | 97% | 1000g | 0 | $ 70.98 | ~30 days | |
| Apinno | GC68256 | Diethylethylmalonate | 97% | 100g | 0 | $ 11.20 | ~30 days | |
| Apinno | GC68256 | Diethylethylmalonate | 97% | 500g | 0 | $ 35.70 | ~30 days |
Diethylglutarate
CasNo： 818-38-2
Categories： Carboxylic Acids & Derivatives (Esters, Acyl Chlorides)
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC69499 | Diethylglutarate | 99% | 100g | 0 | $ 23.52 | ~30 days | |
| Apinno | GC69499 | Diethylglutarate | 99% | 10g | 0 | $ 4.76 | ~30 days | |
| Apinno | GC69499 | Diethylglutarate | 99% | 25g | 0 | $ 7.70 | ~30 days | |
| Apinno | GC69499 | Diethylglutarate | 99% | 500g | 0 | $ 102.90 | ~30 days |
Diethylglycine, 98%
CasNo： 1606-01-5
Categories： Carboxylic Acids & Derivatives (Esters, Acyl Chlorides)
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A22252 | Diethylglycine, 98% | 98.00% | 250mg | 3 | $ 25.34 | 7-14 days | |
| Innochem | A22252 | Diethylglycine, 98% | 98.00% | 1g | 3 | $ 51.10 | 7-14 days | |
| Apinno | GC32854 | Diethylglycine | 97% | 100mg | 0 | $ 20.02 | ~30 days | |
| Apinno | GC32854 | Diethylglycine | 97% | 1g | 0 | $ 90.16 | ~30 days | |
| Apinno | GC32854 | Diethylglycine | 97% | 250mg | 0 | $ 28.56 | ~30 days |
Diethylheptanedioate
CasNo： 2050-20-6
Categories： Carboxylic Acids & Derivatives (Esters, Acyl Chlorides)
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC80445 | Diethylheptanedioate | 95% | 100g | 0 | $ 51.10 | ~30 days | |
| Apinno | GC80445 | Diethylheptanedioate | 95% | 25g | 0 | $ 20.16 | ~30 days | |
| Apinno | GC80445 | Diethylheptanedioate | 95% | 500g | 0 | $ 254.66 | ~30 days |
Diethylisoamylmalonate
CasNo： 5398-08-3
Categories： Carboxylic Acids & Derivatives (Esters, Acyl Chlorides)
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC68829 | Diethylisoamylmalonate | 98% | 10g | 0 | $ 140.00 | ~30 days | |
| Apinno | GC68829 | Diethylisoamylmalonate | 98% | 1g | 0 | $ 31.08 | ~30 days | |
| Apinno | GC68829 | Diethylisoamylmalonate | 98% | 250mg | 0 | $ 19.32 | ~30 days | |
| Apinno | GC68829 | Diethylisoamylmalonate | 98% | 25g | 0 | $ 259.56 | ~30 days | |
| Apinno | GC68829 | Diethylisoamylmalonate | 98% | 5g | 0 | $ 77.84 | ~30 days |
Diethylisobutylmalonate
CasNo： 10203-58-4
Categories： Carboxylic Acids & Derivatives (Esters, Acyl Chlorides)
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC68177 | Diethylisobutylmalonate | 97% | 100g | 0 | $ 80.08 | ~30 days | |
| Apinno | GC68177 | Diethylisobutylmalonate | 97% | 10g | 0 | $ 22.26 | ~30 days | |
| Apinno | GC68177 | Diethylisobutylmalonate | 97% | 25g | 0 | $ 24.22 | ~30 days |