CasNo: 83622-42-8
Categories: Organoboron Compounds
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A57796 | 2-(Chloromethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% | 25g | 0 | $ 218.12 | ~30 days | ||
| Innochem | A57796 | 2-(Chloromethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% | 250mg | 0 | $ 21.42 | ~30 days | ||
| Innochem | A57796 | 2-(Chloromethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% | 1g | 0 | $ 63.56 | ~30 days | ||
| Innochem | A57796 | 2-(Chloromethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% | 5g | 0 | $ 190.12 | ~30 days | ||
| Apinno | GC24745 | 2-(Chloromethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | 98% | 100g | 0 | $ 170.52 | ~30 days | |
| Apinno | GC24745 | 2-(Chloromethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | 98% | 10g | 0 | $ 73.92 | ~30 days | |
| Apinno | GC24745 | 2-(Chloromethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | 98% | 25g | 0 | $ 42.98 | ~30 days | |
| Apinno | GC24745 | 2-(Chloromethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | 98% | 5g | 0 | $ 13.44 | ~30 days | |
| Apinno | GC37457 | Chloromethylboronic acid pinacol ester | 97% | 100g | 0 | $ 526.82 | ~30 days | |
| Apinno | GC37457 | Chloromethylboronic acid pinacol ester | 97% | 10g | 0 | $ 73.50 | ~30 days | |
| Apinno | GC37457 | Chloromethylboronic acid pinacol ester | 97% | 25g | 0 | $ 150.78 | ~30 days | |
| Apinno | GC37457 | Chloromethylboronic acid pinacol ester | 97% | 5g | 0 | $ 37.94 | ~30 days |
CasNo: 67317-62-8
Categories: Organic Building Blocks—Chlorides
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC35235 | chloromethyldecanoate | 97% | 1g | 0 | $ 268.80 | ~30 days |
CasNo: 1833-51-8
Categories: Organosilicon Compounds
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A56951 | Chloromethyldimethylphenylsilane 97% | 97% | 25g | 0 | $ 106.40 | ~30 days | |
| Innochem | A56951 | Chloromethyldimethylphenylsilane 97% | 97% | 5g | 0 | $ 43.26 | ~30 days |
CasNo: 35179-98-7
Categories: Organic Building Blocks—Chlorides
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC86676 | Chloromethylethylcarbonate | 97% | 100g | 0 | $ 112.00 | ~30 days | |
| Apinno | GC86676 | Chloromethylethylcarbonate | 97% | 10g | 0 | $ 185.36 | ~30 days | |
| Apinno | GC86676 | Chloromethylethylcarbonate | 97% | 1g | 0 | $ 27.02 | ~30 days | |
| Apinno | GC86676 | Chloromethylethylcarbonate | 97% | 25g | 0 | $ 51.24 | ~30 days | |
| Apinno | GC86676 | Chloromethylethylcarbonate | 97% | 5g | 0 | $ 16.94 | ~30 days |
CasNo: 3188-13-4
Molecular Formula: C3H7ClO
Molecular Weight: 94.54
Categories: Organic Building Blocks—Chlorides
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A83462 | Chloromethyl ethyl ether, 95% | 95% | 25g | 0 | $ 15.26 | ~30 days | |
| Innochem | A83462 | Chloromethyl ethyl ether, 95% | 95% | 100G | 0 | $ 55.72 | ~30 days | |
| Innochem | A83462 | Chloromethyl ethyl ether, 95% | 95% | 5G | 0 | $ 4.20 | ~30 days | |
| Innochem | A83462 | Chloromethyl ethyl ether, 95% | 95% | 500g | 0 | $ 334.74 | ~30 days | |
| Innochem | A83462 | Chloromethyl ethyl ether, 95% | 95% | 4g | 0 | $ 3.50 | ~30 days | |
| Innochem | A83462 | Chloromethyl ethyl ether, 95% | 95% | 40G | 0 | $ 39.06 | ~30 days | |
| Innochem | A00012 | Chloromethylethylether,85% | ≥85% | 100G | 0 | $ 17.08 | ~30 days | |
| Innochem | A00012 | Chloromethylethylether,85% | ≥85% | 5G | 15 | $ 3.50 | 7-14 days | |
| Innochem | A00012 | Chloromethylethylether,85% | ≥85% | 25g | 7 | $ 12.60 | 7-14 days |
CasNo: 93765-68-5
Categories: Heterocyclic Building Blocks—Nitrogen Heterocycles
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC35061 | Chloromethyl morpholine-4-carboxylate | 97% | 100mg | 0 | $ 34.30 | ~30 days | |
| Apinno | GC35061 | Chloromethyl morpholine-4-carboxylate | 97% | 1g | 0 | $ 128.10 | ~30 days | |
| Apinno | GC35061 | Chloromethyl morpholine-4-carboxylate | 97% | 250mg | 0 | $ 50.68 | ~30 days | |
| Apinno | GC35061 | Chloromethyl morpholine-4-carboxylate | 97% | 5g | 0 | $ 447.58 | ~30 days | |
| Apinno | GC50423 | Chloromethylmorpholine-4-carboxylate | 97% | 100mg | 0 | $ 9.66 | ~30 days | |
| Apinno | GC50423 | Chloromethylmorpholine-4-carboxylate | 97% | 1g | 0 | $ 40.88 | ~30 days | |
| Apinno | GC50423 | Chloromethylmorpholine-4-carboxylate | 97% | 250mg | 0 | $ 18.90 | ~30 days | |
| Apinno | GC50423 | Chloromethylmorpholine-4-carboxylate | 97% | 5g | 0 | $ 199.22 | ~30 days |
CasNo: 5926-26-1
Categories: Organosilicon Compounds
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC71753 | Chloromethyltrimethoxysilane | 95% | 100g | 0 | $ 70.70 | ~30 days | |
| Apinno | GC71753 | Chloromethyltrimethoxysilane | 95% | 25g | 0 | $ 22.82 | ~30 days |
CasNo: 2344-80-1
Molecular Formula: C4H11ClSi
Molecular Weight: 122.67
Categories: Organic Building Blocks—Silicon-containing Compounds
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A38352 | Chloromethyltrimethylsilane, 98% | ≥98% | 25ML | 3 | $ 12.32 | 7-14 days | |
| Innochem | A38352 | Chloromethyltrimethylsilane, 98% | ≥98% | 5ML | 4 | $ 4.20 | 7-14 days | |
| Innochem | A38352 | Chloromethyltrimethylsilane, 98% | ≥98% | 100ML | 4 | $ 38.92 | 7-14 days | |
| Innochem | A38352 | Chloromethyltrimethylsilane, 98% | ≥98% | 500ml | 3 | $ 104.16 | 7-14 days | |
| Innochem | A38352 | Chloromethyltrimethylsilane, 98% | ≥98% | 96ml | 0 | $ 37.10 | ~30 days | |
| Apinno | GC42535 | (Chloromethyl)trimethylsilane | 95% | 100ml | 0 | $ 69.86 | ~30 days | |
| Apinno | GC42535 | (Chloromethyl)trimethylsilane | 95% | 250ML | 0 | $ 89.46 | ~30 days | |
| Apinno | GC42535 | (Chloromethyl)trimethylsilane | 95% | 25ML | 0 | $ 23.66 | ~30 days | |
| Apinno | GC42535 | (Chloromethyl)trimethylsilane | 95% | 500ml | 0 | $ 104.16 | ~30 days |
CasNo: 1028206-60-1
Categories: Other Transition Metal Catalysts
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Apinno | GC83940 | chloropalladium(1+),dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane,2-methoxy-2-methylpropane,2-phenylethanamine | 98% | 100mg | 0 | $ 11.06 | ~30 days | |
| Apinno | GC83940 | chloropalladium(1+),dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane,2-methoxy-2-methylpropane,2-phenylethanamine | 98% | 1g | 0 | $ 39.90 | ~30 days | |
| Apinno | GC83940 | chloropalladium(1+),dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane,2-methoxy-2-methylpropane,2-phenylethanamine | 98% | 250mg | 0 | $ 19.04 | ~30 days | |
| Apinno | GC83940 | chloropalladium(1+),dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane,2-methoxy-2-methylpropane,2-phenylethanamine | 98% | 5g | 0 | $ 183.40 | ~30 days |
CasNo: 1560-28-7
Categories: Organosilicon Compounds
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A67151 | Chloropentamethyldisilane,97% | 97% | 10g | 0 | $ 137.06 | ~30 days | |
| Innochem | A67151 | Chloropentamethyldisilane,97% | 97% | 5g | 0 | $ 64.96 | ~30 days | |
| Apinno | GC42355 | Chloropentamethyldisilane | 95% | 1g | 0 | $ 15.26 | ~30 days | |
| Apinno | GC42355 | Chloropentamethyldisilane | 95% | 25g | 0 | $ 209.58 | ~30 days | |
| Apinno | GC42355 | Chloropentamethyldisilane | 95% | 5g | 0 | $ 66.22 | ~30 days | |
| Apinno | GC71663 | Chloropentamethyldisilane | 95% | 1g | 0 | $ 19.18 | ~30 days | |
| Apinno | GC71663 | Chloropentamethyldisilane | 95% | 25g | 0 | $ 235.06 | ~30 days | |
| Apinno | GC71663 | Chloropentamethyldisilane | 95% | 5g | 0 | $ 64.96 | ~30 days |
CasNo: 14508-49-7
Molecular Formula: C4H3ClN2
Molecular Weight: 114.53
Categories: Heterocyclic Building Blocks—Nitrogen Heterocycles
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A57510 | Chloropyrazine, 98% | ≥98% | 100G | 0 | $ 8.12 | ~30 days | |
| Innochem | A57510 | Chloropyrazine, 98% | ≥98% | 25G | 0 | $ 3.22 | ~30 days | |
| Innochem | A57510 | Chloropyrazine, 98% | ≥98% | 5G | 6 | $ 2.66 | 7-14 days | |
| Innochem | A57510 | Chloropyrazine, 98% | 98% | 500G | 0 | $ 37.80 | ~30 days |
CasNo: 2921-88-2
Categories: Organic Building Blocks—Chlorides
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | C3003 | CHLOROPYRIFOS, 96% | 200G | 0 | $ 210.00 | ~30 days |
CasNo: 50-63-5
Molecular Formula: C18H26ClN3 · 2H3PO4
Molecular Weight: 515.86
Categories: Organophosphorus Compounds
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A65517 | Chloroquine diphosphate, 99% | ≥99% | 100g | 5 | $ 26.46 | 7-14 days | |
| Innochem | A65517 | Chloroquine diphosphate, 99% | ≥99% | 10g | 14 | $ 5.60 | 7-14 days | |
| Innochem | A65517 | Chloroquine diphosphate, 99% | ≥99% | 25g | 11 | $ 8.82 | 7-14 days | |
| Innochem | A65517 | Chloroquine diphosphate, 99% | ≥99% | 500g | 1 | $ 131.88 | 7-14 days | |
| Innochem | A24471 | Chloroquine diphosphate salt | 分析标准品 | 250mg | 0 | $ 38.97 | ~30 days |
CasNo: 54-05-7
Molecular Formula: C18H26ClN3
Molecular Weight: 319.88
Categories: Heterocyclic Building Blocks—Nitrogen Heterocycles
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A88133 | Chloroquine, 96% | ≥96% | 1g | 4 | $ 58.38 | 7-14 days | |
| Innochem | A88133 | Chloroquine, 96% | ≥96% | 250mg | 2 | $ 17.08 | 7-14 days | |
| Innochem | A88133 | Chloroquine, 96% | ≥96% | 10g | 0 | $ 0.00 | ~30 days | |
| Innochem | A88133 | Chloroquine, 96% | ≥96% | 100mg | 0 | $ 8.26 | ~30 days | |
| Apinno | GC87939 | N4-(7-Chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine | 1g | 0 | $ 22.96 | ~30 days | ||
| Apinno | GC87939 | N4-(7-Chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine | 5g | 0 | $ 90.86 | ~30 days | ||
| Apinno | GC87939 | N4-(7-Chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine | 25g | 0 | $ 391.16 | ~30 days |
CasNo: 7790-94-5
Molecular Formula: HClO3S
Molecular Weight: 116.52
Categories: Sulfoxides, Sulfonic Acids, Sulfinic Acids and Derivatives
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A83033 | ChlorosulfonicAcid,99% | ≥99% | 100ml | 0 | $ 27.86 | ~30 days | |
| Innochem | A83033 | ChlorosulfonicAcid,99% | ≥99% | 500ml | 95 | $ 83.86 | 7-14 days | |
| Apinno | GC68151 | 工业级别 | 4KG | 0 | $ 196.00 | ~30 days |
CasNo: 1189-71-5
Molecular Formula: CClNO3S
Molecular Weight: 141.53
Categories: Sulfoxides, Sulfonic Acids, Sulfinic Acids and Derivatives
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A54676 | Chlorosulfonyl isocyanate, 98% | ≥98% | 25g | 0 | $ 6.02 | ~30 days | |
| Innochem | A54676 | Chlorosulfonyl isocyanate, 98% | ≥98% | 100g | 1 | $ 8.40 | 7-14 days | |
| Innochem | A54676 | Chlorosulfonyl isocyanate, 98% | ≥98% | 500g | 0 | $ 30.80 | ~30 days | |
| Innochem | A54676 | Chlorosulfonyl isocyanate, 98% | ≥98% | 1kg | 0 | $ 0.00 | ~30 days | |
| Innochem | A54676 | Chlorosulfonyl isocyanate, 98% | ≥98% | 5kg | 0 | $ 0.00 | ~30 days |
CasNo: 20717-86-6
Molecular Formula: C9H21ClO3Ti
Molecular Weight: 260.58
Categories: Organic Building Blocks—Chlorides
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | A41102 | Chlorotitanium triisopropoxide, 95% | 95% | 500g | 0 | $ 403.20 | ~30 days | |
| Innochem | A41102 | Chlorotitanium triisopropoxide, 95% | 95% | 100G | 0 | $ 84.84 | ~30 days | |
| Innochem | A41102 | Chlorotitanium triisopropoxide, 95% | 95% | 25G | 0 | $ 24.08 | ~30 days |
CasNo: 1461-22-9
Molecular Formula: C12H27ClSn
Molecular Weight: 325.48
Categories: Organotin Compounds
| Brand | Catalog Number | Description | Specification | Package | Stock | Price | Ship Time | Operation |
|---|---|---|---|---|---|---|---|---|
| Innochem | T3201 | Chlorotributyltin, 98% | ≥98% | 50G | 0 | $ 8.40 | ~30 days | |
| Innochem | T3201 | Chlorotributyltin, 98% | ≥98% | 100g | 11 | $ 14.00 | 7-14 days | |
| Innochem | T3201 | Chlorotributyltin, 98% | ≥98% | 25g | 5 | $ 4.90 | 7-14 days | |
| Innochem | T3201 | Chlorotributyltin, 98% | ≥98% | 500g | 12 | $ 44.80 | 7-14 days | |
| Innochem | T3201 | Chlorotributyltin, 98% | ≥98% | 7g | 0 | $ 3.50 | ~30 days | |
| Innochem | T3201 | Chlorotributyltin, 98% | ≥98% | 20kg | 0 | $ 1,254.40 | ~30 days |